C21H25NO4 — CID 95266560
(E)-1-[(2S)-2-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one (PubChem CID 95266560) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (E)-1-[(2S)-2-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 95266560 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (E)-1-[(2S)-2-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(2-ethyl-1-benzofuran-3-yl)prop-2-en-1-one |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N1CCCC[C@H]1C1OCCO1 |
| InChI | InChI=1S/C21H25NO4/c1-2-18-16(15-7-3-4-9-19(15)26-18)10-11-20(23)22-12-6-5-8-17(22)21-24-13-14-25-21/h3-4,7,9-11,17,21H,2,5-6,8,12-14H2,1H3/b11-10+/t17-/m0/s1 |
| InChIKey | PMQNVWHMEORTTI-DVQDXYAYSA-N |
| XLogP | 3.76 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|