C16H22N2O3 — CID 95268349
(2S)-N-benzyl-2-(1,3-dioxolan-2-yl)piperidine-1-carboxamide (PubChem CID 95268349) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(1,3-dioxolan-2-yl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-benzyl-2-(1,3-dioxolan-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95268349 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2S)-N-benzyl-2-(1,3-dioxolan-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCCC[C@H]1C1OCCO1 |
| InChI | InChI=1S/C16H22N2O3/c19-16(17-12-13-6-2-1-3-7-13)18-9-5-4-8-14(18)15-20-10-11-21-15/h1-3,6-7,14-15H,4-5,8-12H2,(H,17,19)/t14-/m0/s1 |
| InChIKey | JRHLDOAFXPISPW-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |