C19H21NO4S — CID 9084231
methyl (2S)-4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]thiomorpholine-2-carboxylate (PubChem CID 9084231) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is methyl (2S)-4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9084231 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl (2S)-4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]thiomorpholine-2-carboxylate |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N1CCS[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C19H21NO4S/c1-3-15-14(13-6-4-5-7-16(13)24-15)8-9-18(21)20-10-11-25-17(12-20)19(22)23-2/h4-9,17H,3,10-12H2,1-2H3/b9-8+/t17-/m0/s1 |
| InChIKey | NABAIAQFOXLQRD-IJDCCNJMSA-N |
| XLogP | 3.13 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|