C16H24BrN3OS — CID 119832814
(1-aminocyclohexyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 119832814) has the molecular formula C16H24BrN3OS and a molecular weight of 386.36 g/mol. Its IUPAC name is (1-aminocyclohexyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (1-aminocyclohexyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119832814 |
| Molecular Formula | C16H24BrN3OS |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (1-aminocyclohexyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCN(Cc3ccc(Br)s3)CC2)CCCCC1 |
| InChI | InChI=1S/C16H24BrN3OS/c17-14-5-4-13(22-14)12-19-8-10-20(11-9-19)15(21)16(18)6-2-1-3-7-16/h4-5H,1-3,6-12,18H2 |
| InChIKey | IKPZGPCAXCIVSL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |