C14H21BrN2O2S — CID 55361410
2-methylpropyl 4-[(5-bromothiophen-2-yl)methyl]piperazine-1-carboxylate (PubChem CID 55361410) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-methylpropyl 4-[(5-bromothiophen-2-yl)methyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[(5-bromothiophen-2-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55361410 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-methylpropyl 4-[(5-bromothiophen-2-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C14H21BrN2O2S/c1-11(2)10-19-14(18)17-7-5-16(6-8-17)9-12-3-4-13(15)20-12/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | KZAVBGSPUVZKCS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |