C19H23BrN2OS — CID 55359604
1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-phenylbutan-1-one (PubChem CID 55359604) has the molecular formula C19H23BrN2OS and a molecular weight of 407.38 g/mol. Its IUPAC name is 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-phenylbutan-1-one.
| Compound Name | 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 55359604 |
| Molecular Formula | C19H23BrN2OS |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-3-phenylbutan-1-one |
| SMILES | CC(CC(=O)N1CCN(Cc2ccc(Br)s2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H23BrN2OS/c1-15(16-5-3-2-4-6-16)13-19(23)22-11-9-21(10-12-22)14-17-7-8-18(20)24-17/h2-8,15H,9-14H2,1H3 |
| InChIKey | MFDJVYIOUQJHFQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |