C15H21BrN2O2S — CID 110800957
1-[4-[2-(5-bromothiophen-2-yl)acetyl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 110800957) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 1-[4-[2-(5-bromothiophen-2-yl)acetyl]piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[2-(5-bromothiophen-2-yl)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110800957 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-[4-[2-(5-bromothiophen-2-yl)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C15H21BrN2O2S/c1-11(2)9-14(19)17-5-7-18(8-6-17)15(20)10-12-3-4-13(16)21-12/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | WKFSPAHQSLMNGX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |