C14H19BrN2O3 — CID 106853503
1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 106853503) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 106853503 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)c2ccoc2Br)CC1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-10(2)9-12(18)16-4-6-17(7-5-16)14(19)11-3-8-20-13(11)15/h3,8,10H,4-7,9H2,1-2H3 |
| InChIKey | LKHFDGWAKFGHNR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |