C11H15BrN4O3 — CID 106855786
2-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 106855786) has the molecular formula C11H15BrN4O3 and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 106855786 |
| Molecular Formula | C11H15BrN4O3 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | N/C(CN1CCN(C(=O)c2ccoc2Br)CC1)=N/O |
| InChI | InChI=1S/C11H15BrN4O3/c12-10-8(1-6-19-10)11(17)16-4-2-15(3-5-16)7-9(13)14-18/h1,6,18H,2-5,7H2,(H2,13,14) |
| InChIKey | WYPCHTNUSFTKRR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|