C12H15BrN2O4 — CID 106853497
1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-2-methoxyethanone (PubChem CID 106853497) has the molecular formula C12H15BrN2O4 and a molecular weight of 331.17 g/mol. Its IUPAC name is 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 106853497 |
| Molecular Formula | C12H15BrN2O4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1-[4-(2-bromofuran-3-carbonyl)piperazin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(C(=O)c2ccoc2Br)CC1 |
| InChI | InChI=1S/C12H15BrN2O4/c1-18-8-10(16)14-3-5-15(6-4-14)12(17)9-2-7-19-11(9)13/h2,7H,3-6,8H2,1H3 |
| InChIKey | GAQQUEFBPBFYMV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |