C14H16Br2N2O3 — CID 103882529
1-[4-(2,4-dibromobenzoyl)piperazin-1-yl]-2-methoxyethanone (PubChem CID 103882529) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 1-[4-(2,4-dibromobenzoyl)piperazin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-(2,4-dibromobenzoyl)piperazin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 103882529 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1-[4-(2,4-dibromobenzoyl)piperazin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(C(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C14H16Br2N2O3/c1-21-9-13(19)17-4-6-18(7-5-17)14(20)11-3-2-10(15)8-12(11)16/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | JLCBQSOLMOGBCD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |