C10H12BrNO2 — CID 106853680
(2-bromofuran-3-yl)-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 106853680) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106853680 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (2-bromofuran-3-yl)-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccoc2Br)C1 |
| InChI | InChI=1S/C10H12BrNO2/c1-7-2-4-12(6-7)10(13)8-3-5-14-9(8)11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | CGHYMLJDWUCVOA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |