C11H13BrClNO2 — CID 106856247
(2-bromofuran-3-yl)-(3-chloro-4-methylpiperidin-1-yl)methanone (PubChem CID 106856247) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(3-chloro-4-methylpiperidin-1-yl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(3-chloro-4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 106856247 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | (2-bromofuran-3-yl)-(3-chloro-4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccoc2Br)CC1Cl |
| InChI | InChI=1S/C11H13BrClNO2/c1-7-2-4-14(6-9(7)13)11(15)8-3-5-16-10(8)12/h3,5,7,9H,2,4,6H2,1H3 |
| InChIKey | QJIPSTVQIFBEGK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|