C10H12BrNO3 — CID 106854462
(2-bromofuran-3-yl)-(3-methoxypyrrolidin-1-yl)methanone (PubChem CID 106854462) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(3-methoxypyrrolidin-1-yl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(3-methoxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106854462 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2-bromofuran-3-yl)-(3-methoxypyrrolidin-1-yl)methanone |
| SMILES | COC1CCN(C(=O)c2ccoc2Br)C1 |
| InChI | InChI=1S/C10H12BrNO3/c1-14-7-2-4-12(6-7)10(13)8-3-5-15-9(8)11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | SRGQOHWXXHSPHQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |