C10H12BrNO3 — CID 131196683
(2-bromofuran-3-yl)-(3-hydroxy-4-methylpyrrolidin-1-yl)methanone (PubChem CID 131196683) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(3-hydroxy-4-methylpyrrolidin-1-yl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(3-hydroxy-4-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 131196683 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2-bromofuran-3-yl)-(3-hydroxy-4-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccoc2Br)CC1O |
| InChI | InChI=1S/C10H12BrNO3/c1-6-4-12(5-8(6)13)10(14)7-2-3-15-9(7)11/h2-3,6,8,13H,4-5H2,1H3 |
| InChIKey | SZPXCBQPBGXKHB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |