C12H16BrN5O2 — CID 77011992
2-[4-(5-bromopyridine-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 77011992) has the molecular formula C12H16BrN5O2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-[4-(5-bromopyridine-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(5-bromopyridine-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77011992 |
| Molecular Formula | C12H16BrN5O2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[4-(5-bromopyridine-3-carbonyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCN(C(=O)c2cncc(Br)c2)CC1)=NO |
| InChI | InChI=1S/C12H16BrN5O2/c13-10-5-9(6-15-7-10)12(19)18-3-1-17(2-4-18)8-11(14)16-20/h5-7,20H,1-4,8H2,(H2,14,16) |
| InChIKey | UKMJSQUBISJPPS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|