C13H16F2N4O2 — CID 77011940
2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 77011940) has the molecular formula C13H16F2N4O2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77011940 |
| Molecular Formula | C13H16F2N4O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCN(C(=O)c2cc(F)ccc2F)CC1)=NO |
| InChI | InChI=1S/C13H16F2N4O2/c14-9-1-2-11(15)10(7-9)13(20)19-5-3-18(4-6-19)8-12(16)17-21/h1-2,7,21H,3-6,8H2,(H2,16,17) |
| InChIKey | RVOVTKDUAUOEOE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|