C13H15F2N3OS — CID 63336111
2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]ethanethioamide (PubChem CID 63336111) has the molecular formula C13H15F2N3OS and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63336111 |
| Molecular Formula | C13H15F2N3OS |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[4-(2,5-difluorobenzoyl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C13H15F2N3OS/c14-9-1-2-11(15)10(7-9)13(19)18-5-3-17(4-6-18)8-12(16)20/h1-2,7H,3-6,8H2,(H2,16,20) |
| InChIKey | BNPHWPUZFPLURS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|