C12H15FN4OS — CID 64948717
2-[4-(3-fluoropyridine-4-carbonyl)piperazin-1-yl]ethanethioamide (PubChem CID 64948717) has the molecular formula C12H15FN4OS and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[4-(3-fluoropyridine-4-carbonyl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(3-fluoropyridine-4-carbonyl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 64948717 |
| Molecular Formula | C12H15FN4OS |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[4-(3-fluoropyridine-4-carbonyl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(C(=O)c2ccncc2F)CC1 |
| InChI | InChI=1S/C12H15FN4OS/c13-10-7-15-2-1-9(10)12(18)17-5-3-16(4-6-17)8-11(14)19/h1-2,7H,3-6,8H2,(H2,14,19) |
| InChIKey | RAJHABPLYGYFKJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|