C14H15FN2O — CID 121184189
(4-cyclopropylidenepiperidin-1-yl)-(3-fluoro-4-pyridinyl)methanone (PubChem CID 121184189) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is (4-cyclopropylidenepiperidin-1-yl)-(3-fluoro-4-pyridinyl)methanone.
| Compound Name | (4-cyclopropylidenepiperidin-1-yl)-(3-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 121184189 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (4-cyclopropylidenepiperidin-1-yl)-(3-fluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1F)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C14H15FN2O/c15-13-9-16-6-3-12(13)14(18)17-7-4-11(5-8-17)10-1-2-10/h3,6,9H,1-2,4-5,7-8H2 |
| InChIKey | SLYMVDZVIIEVOP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|