C12H10F4N2O — CID 115772156
(3-fluoro-4-pyridinyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 115772156) has the molecular formula C12H10F4N2O and a molecular weight of 274.22 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 115772156 |
| Molecular Formula | C12H10F4N2O |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1ccncc1F)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H10F4N2O/c13-10-7-17-4-1-9(10)11(19)18-5-2-8(3-6-18)12(14,15)16/h1-2,4,7H,3,5-6H2 |
| InChIKey | QFJGOLNGHXUANZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|