C13H9F6NO — CID 115772196
[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 115772196) has the molecular formula C13H9F6NO and a molecular weight of 309.21 g/mol. Its IUPAC name is [4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 115772196 |
| Molecular Formula | C13H9F6NO |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H9F6NO/c14-9-5-7(6-10(15)11(9)16)12(21)20-3-1-8(2-4-20)13(17,18)19/h1,5-6H,2-4H2 |
| InChIKey | XTTMWVFQPUMKHW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|