C14H14BrF3N2O — CID 107873192
(3-amino-5-bromo-2-methylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 107873192) has the molecular formula C14H14BrF3N2O and a molecular weight of 363.18 g/mol. Its IUPAC name is (3-amino-5-bromo-2-methylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (3-amino-5-bromo-2-methylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 107873192 |
| Molecular Formula | C14H14BrF3N2O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (3-amino-5-bromo-2-methylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H14BrF3N2O/c1-8-11(6-10(15)7-12(8)19)13(21)20-4-2-9(3-5-20)14(16,17)18/h2,6-7H,3-5,19H2,1H3 |
| InChIKey | JAKSXUMDSBLRCC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|