C11H8Br2F3NOS — CID 115772185
(4,5-dibromothiophen-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 115772185) has the molecular formula C11H8Br2F3NOS and a molecular weight of 419.06 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 115772185 |
| Molecular Formula | C11H8Br2F3NOS |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 416.86 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H8Br2F3NOS/c12-7-5-8(19-9(7)13)10(18)17-3-1-6(2-4-17)11(14,15)16/h1,5H,2-4H2 |
| InChIKey | LICBNUYTQPZYLB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|