C13H12F3NOS — CID 107036318
(3-sulfanylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 107036318) has the molecular formula C13H12F3NOS and a molecular weight of 287.31 g/mol. Its IUPAC name is (3-sulfanylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (3-sulfanylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 107036318 |
| Molecular Formula | C13H12F3NOS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (3-sulfanylphenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1cccc(S)c1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H12F3NOS/c14-13(15,16)10-4-6-17(7-5-10)12(18)9-2-1-3-11(19)8-9/h1-4,8,19H,5-7H2 |
| InChIKey | GHDGKZPOWQALKH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|