C13H12F4N2O — CID 114489305
(2-amino-4-fluorophenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 114489305) has the molecular formula C13H12F4N2O and a molecular weight of 288.24 g/mol. Its IUPAC name is (2-amino-4-fluorophenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2-amino-4-fluorophenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 114489305 |
| Molecular Formula | C13H12F4N2O |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (2-amino-4-fluorophenyl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | Nc1cc(F)ccc1C(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H12F4N2O/c14-9-1-2-10(11(18)7-9)12(20)19-5-3-8(4-6-19)13(15,16)17/h1-3,7H,4-6,18H2 |
| InChIKey | DPVCSPVESPBMHR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|