C11H9BrF3NO2 — CID 115772130
(5-bromofuran-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 115772130) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 115772130 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H9BrF3NO2/c12-9-2-1-8(18-9)10(17)16-5-3-7(4-6-16)11(13,14)15/h1-3H,4-6H2 |
| InChIKey | JHEMINIETBRKKZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|