C13H17FN4O3 — CID 107016252
2-[4-(2-fluoro-6-hydroxybenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 107016252) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-[4-(2-fluoro-6-hydroxybenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(2-fluoro-6-hydroxybenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 107016252 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[4-(2-fluoro-6-hydroxybenzoyl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | N/C(CN1CCN(C(=O)c2c(O)cccc2F)CC1)=N/O |
| InChI | InChI=1S/C13H17FN4O3/c14-9-2-1-3-10(19)12(9)13(20)18-6-4-17(5-7-18)8-11(15)16-21/h1-3,19,21H,4-8H2,(H2,15,16) |
| InChIKey | GSZUTPZCPVPDMP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|