About 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate
2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate (PubChem CID 68835926) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate |
| PubChem CID | 68835926 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-13(2)12-21-16(20)19-9-7-18(8-10-19)11-14-3-5-15(17)6-4-14/h3-6,13H,7-12,17H2,1-2H3 |
| InChIKey | RNYGJFGCSTXFCP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate (CID 68835926) is 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate is CC(C)COC(=O)N1CCN(Cc2ccc(N)cc2)CC1.
What is the InChIKey of 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate?
The InChIKey is RNYGJFGCSTXFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-13(2)12-21-16(20)19-9-7-18(8-10-19)11-14-3-5-15(17)6-4-14/h3-6,13H,7-12,17H2,1-2H3.
What are the key properties of 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate?
2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate has a molecular weight of 291.39 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[(4-aminophenyl)methyl]piperazine-1-carboxylate is sourced from PubChem (CID 68835926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).