C25H24ClN3O2S — CID 26291728
N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 26291728) has the molecular formula C25H24ClN3O2S and a molecular weight of 466.01 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26291728 |
| Molecular Formula | C25H24ClN3O2S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | Cc1sc(NC(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O2S/c1-17-23(19-8-10-21(26)11-9-19)27-25(32-17)28-24(31)20-13-15-29(16-14-20)22(30)12-7-18-5-3-2-4-6-18/h2-12,20H,13-16H2,1H3,(H,27,28,31)/b12-7+ |
| InChIKey | YSGVYNYIJJDBCE-KPKJPENVSA-N |
| XLogP | 5.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|