C13H13ClF3N3O4 — CID 2367757
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)propanoate (PubChem CID 2367757) has the molecular formula C13H13ClF3N3O4 and a molecular weight of 367.71 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)propanoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 2367757 |
| Molecular Formula | C13H13ClF3N3O4 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)propanoate |
| SMILES | C[C@@H](NC(N)=O)C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H13ClF3N3O4/c1-6(19-12(18)23)11(22)24-5-10(21)20-9-4-7(13(15,16)17)2-3-8(9)14/h2-4,6H,5H2,1H3,(H,20,21)(H3,18,19,23)/t6-/m1/s1 |
| InChIKey | FEZNHONGFPNSKY-ZCFIWIBFSA-N |
| XLogP | 1.90 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |