C17H13F3N2O7 — CID 33278416
[2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 33278416) has the molecular formula C17H13F3N2O7 and a molecular weight of 414.29 g/mol. Its IUPAC name is [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 33278416 |
| Molecular Formula | C17H13F3N2O7 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | COc1ccc(O)c(C(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13F3N2O7/c1-28-10-3-5-14(23)11(7-10)16(25)29-8-15(24)21-12-4-2-9(17(18,19)20)6-13(12)22(26)27/h2-7,23H,8H2,1H3,(H,21,24) |
| InChIKey | ALEKDVNEZNGDJJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|