C19H19F3N6O2 — CID 18283606
(1-butyltetrazol-5-yl)methyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 18283606) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18283606 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | CCCCn1nnnc1COC(=O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N6O2/c1-2-3-10-28-16(25-26-27-28)12-30-18(29)15-8-5-9-23-17(15)24-14-7-4-6-13(11-14)19(20,21)22/h4-9,11H,2-3,10,12H2,1H3,(H,23,24) |
| InChIKey | IJYDBGSDDUXFQT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |