C14H14ClN3O2 — CID 107062918
3-chloro-2-[(3-ethyl-2-pyridinyl)methylamino]pyridine-4-carboxylic acid (PubChem CID 107062918) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 3-chloro-2-[(3-ethyl-2-pyridinyl)methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[(3-ethyl-2-pyridinyl)methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107062918 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-chloro-2-[(3-ethyl-2-pyridinyl)methylamino]pyridine-4-carboxylic acid |
| SMILES | CCc1cccnc1CNc1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H14ClN3O2/c1-2-9-4-3-6-16-11(9)8-18-13-12(15)10(14(19)20)5-7-17-13/h3-7H,2,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | TUAUUCUXMQSENC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |