C13H9F3N4S — CID 103323372
2-N-methyl-4-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103323372) has the molecular formula C13H9F3N4S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-N-methyl-4-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103323372 |
| Molecular Formula | C13H9F3N4S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-N-methyl-4-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(F)c(F)c2F)c2ccsc2n1 |
| InChI | InChI=1S/C13H9F3N4S/c1-17-13-19-11(6-4-5-21-12(6)20-13)18-8-3-2-7(14)9(15)10(8)16/h2-5H,1H3,(H2,17,18,19,20) |
| InChIKey | DXVSYBZUHPWVOY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|