C9H8N4OS — CID 103336010
(4-prop-2-ynoxythieno[2,3-d]pyrimidin-2-yl)hydrazine (PubChem CID 103336010) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is (4-prop-2-ynoxythieno[2,3-d]pyrimidin-2-yl)hydrazine.
| Compound Name | (4-prop-2-ynoxythieno[2,3-d]pyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 103336010 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (4-prop-2-ynoxythieno[2,3-d]pyrimidin-2-yl)hydrazine |
| SMILES | C#CCOc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C9H8N4OS/c1-2-4-14-7-6-3-5-15-8(6)12-9(11-7)13-10/h1,3,5H,4,10H2,(H,11,12,13) |
| InChIKey | RKYNHACFAQSCPS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|