C13H9N5OS — CID 103336137
3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxybenzonitrile (PubChem CID 103336137) has the molecular formula C13H9N5OS and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxybenzonitrile.
| Compound Name | 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 103336137 |
| Molecular Formula | C13H9N5OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxybenzonitrile |
| SMILES | N#Cc1cccc(Oc2nc(NN)nc3sccc23)c1 |
| InChI | InChI=1S/C13H9N5OS/c14-7-8-2-1-3-9(6-8)19-11-10-4-5-20-12(10)17-13(16-11)18-15/h1-6H,15H2,(H,16,17,18) |
| InChIKey | WOMZHRWPOLPLFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|