C12H9BrN4OS — CID 103336191
[4-(3-bromophenoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336191) has the molecular formula C12H9BrN4OS and a molecular weight of 337.20 g/mol. Its IUPAC name is [4-(3-bromophenoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3-bromophenoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336191 |
| Molecular Formula | C12H9BrN4OS |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | [4-(3-bromophenoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(Oc2cccc(Br)c2)c2ccsc2n1 |
| InChI | InChI=1S/C12H9BrN4OS/c13-7-2-1-3-8(6-7)18-10-9-4-5-19-11(9)16-12(15-10)17-14/h1-6H,14H2,(H,15,16,17) |
| InChIKey | FGWOQYQNZUVIRJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|