C10H15N5OS — CID 103336249
2-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxy-N,N-dimethylethanamine (PubChem CID 103336249) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxy-N,N-dimethylethanamine.
| Compound Name | 2-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 103336249 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C10H15N5OS/c1-15(2)4-5-16-8-7-3-6-17-9(7)13-10(12-8)14-11/h3,6H,4-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | HPZMWQUKFHWDFE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|