C10H15N5O2 — CID 67144956
6-[2-(2-methoxyethoxy)ethyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 67144956) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-[2-(2-methoxyethoxy)ethyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[2-(2-methoxyethoxy)ethyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67144956 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-[2-(2-methoxyethoxy)ethyl]-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COCCOCCc1nc(N)c2cn[nH]c2n1 |
| InChI | InChI=1S/C10H15N5O2/c1-16-4-5-17-3-2-8-13-9(11)7-6-12-15-10(7)14-8/h6H,2-5H2,1H3,(H3,11,12,13,14,15) |
| InChIKey | PXTFIEVAXQYMTI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|