C9H14N6O3 — CID 102926611
5-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 102926611) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 102926611 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | COCCOCCc1noc(-c2nc(N)n[nH]2)n1 |
| InChI | InChI=1S/C9H14N6O3/c1-16-4-5-17-3-2-6-11-8(18-15-6)7-12-9(10)14-13-7/h2-5H2,1H3,(H3,10,12,13,14) |
| InChIKey | HPGPRPMHSIFBDB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|