C13H16FN3O3 — CID 102926835
2-fluoro-4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 102926835) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-fluoro-4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-fluoro-4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 102926835 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-fluoro-4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | COCCOCCc1noc(-c2ccc(N)c(F)c2)n1 |
| InChI | InChI=1S/C13H16FN3O3/c1-18-6-7-19-5-4-12-16-13(20-17-12)9-2-3-11(15)10(14)8-9/h2-3,8H,4-7,15H2,1H3 |
| InChIKey | AADXOIYJYKBXNC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|