C12H14ClN3O2 — CID 65094898
2-chloro-5-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 65094898) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-chloro-5-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-chloro-5-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 65094898 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-chloro-5-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | COCCCc1noc(-c2ccc(Cl)c(N)c2)n1 |
| InChI | InChI=1S/C12H14ClN3O2/c1-17-6-2-3-11-15-12(18-16-11)8-4-5-9(13)10(14)7-8/h4-5,7H,2-3,6,14H2,1H3 |
| InChIKey | BOCGWZOASVYUAJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|