C15H11ClFN3O — CID 43329989
2-chloro-5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 43329989) has the molecular formula C15H11ClFN3O and a molecular weight of 303.72 g/mol. Its IUPAC name is 2-chloro-5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-chloro-5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 43329989 |
| Molecular Formula | C15H11ClFN3O |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-chloro-5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cc(-c2nc(Cc3ccc(F)cc3)no2)ccc1Cl |
| InChI | InChI=1S/C15H11ClFN3O/c16-12-6-3-10(8-13(12)18)15-19-14(20-21-15)7-9-1-4-11(17)5-2-9/h1-6,8H,7,18H2 |
| InChIKey | RHJBOVLVVMRPOH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|