About [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol
[3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol (PubChem CID 102929347) has the molecular formula C8H15N3O3
and a molecular weight of 201.23 g/mol. Its IUPAC name is [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol |
| PubChem CID | 102929347 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol |
| SMILES | COCCOCCc1n[nH]c(CO)n1 |
| InChI | InChI=1S/C8H15N3O3/c1-13-4-5-14-3-2-7-9-8(6-12)11-10-7/h12H,2-6H2,1H3,(H,9,10,11) |
| InChIKey | LHTVOJYDXMHCPF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol?
The IUPAC name of [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol (CID 102929347) is [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol.
What is the SMILES notation for [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol?
The canonical SMILES for [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol is COCCOCCc1n[nH]c(CO)n1.
What is the InChIKey of [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol?
The InChIKey is LHTVOJYDXMHCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O3/c1-13-4-5-14-3-2-7-9-8(6-12)11-10-7/h12H,2-6H2,1H3,(H,9,10,11).
What are the key properties of [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol?
[3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol has a molecular weight of 201.23 g/mol, XLogP of -0.50, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(2-methoxyethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanol is sourced from PubChem (CID 102929347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).