About 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine
2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine (PubChem CID 62950744) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine.
Analyze 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine?
The IUPAC name of 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine (CID 62950744) is 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine.
What is the SMILES notation for 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine?
The canonical SMILES for 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine is COCCc1n[nH]c(CCN)n1.
What is the InChIKey of 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine?
The InChIKey is LGWOCWGDHMCTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-12-5-3-7-9-6(2-4-8)10-11-7/h2-5,8H2,1H3,(H,9,10,11).
What are the key properties of 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine?
2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine has a molecular weight of 170.22 g/mol, XLogP of -0.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyethyl)-1H-1,2,4-triazol-5-yl]ethanamine is sourced from PubChem (CID 62950744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).