C9H16F2N4O — CID 103150847
3-[3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]propan-1-amine (PubChem CID 103150847) has the molecular formula C9H16F2N4O and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]propan-1-amine.
| Compound Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 103150847 |
| Molecular Formula | C9H16F2N4O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]propan-1-amine |
| SMILES | NCCCc1nc(CCOCC(F)F)n[nH]1 |
| InChI | InChI=1S/C9H16F2N4O/c10-7(11)6-16-5-3-9-13-8(14-15-9)2-1-4-12/h7H,1-6,12H2,(H,13,14,15) |
| InChIKey | NHPKWKAUOLVCDW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|