C7H12F2N4O — CID 103150841
[3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 103150841) has the molecular formula C7H12F2N4O and a molecular weight of 206.20 g/mol. Its IUPAC name is [3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103150841 |
| Molecular Formula | C7H12F2N4O |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | [3-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | NCc1nc(CCOCC(F)F)n[nH]1 |
| InChI | InChI=1S/C7H12F2N4O/c8-5(9)4-14-2-1-6-11-7(3-10)13-12-6/h5H,1-4,10H2,(H,11,12,13) |
| InChIKey | UMJQQJPNROFNFA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|