C11H14N4O — CID 82568163
[3-(2-phenoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 82568163) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is [3-(2-phenoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-(2-phenoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82568163 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [3-(2-phenoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | NCc1nc(CCOc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H14N4O/c12-8-11-13-10(14-15-11)6-7-16-9-4-2-1-3-5-9/h1-5H,6-8,12H2,(H,13,14,15) |
| InChIKey | OUJYVDRMLIJWNK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |