C11H13N3O — CID 79601055
[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]methanol (PubChem CID 79601055) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is [3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]methanol.
| Compound Name | [3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]methanol |
|---|---|
| PubChem CID | 79601055 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]methanol |
| SMILES | OCc1nc(CCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H13N3O/c15-8-11-12-10(13-14-11)7-6-9-4-2-1-3-5-9/h1-5,15H,6-8H2,(H,12,13,14) |
| InChIKey | CQARLTHXPHHCKO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |